C28H33N3O4 — CID 3867153
[4-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]phenyl]-phenylmethanone (PubChem CID 3867153) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is [4-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]phenyl]-phenylmethanone.
| Compound Name | [4-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 3867153 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | [4-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidine-1-carbonyl]phenyl]-phenylmethanone |
| SMILES | CCOCCOCCn1ccnc1C1CCN(C(=O)c2ccc(C(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H33N3O4/c1-2-34-20-21-35-19-18-30-17-14-29-27(30)24-12-15-31(16-13-24)28(33)25-10-8-23(9-11-25)26(32)22-6-4-3-5-7-22/h3-11,14,17,24H,2,12-13,15-16,18-21H2,1H3 |
| InChIKey | GCAOKESCOKPJAY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|