C23H35N3O4S — CID 3419642
4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]-1-(4-propylphenyl)sulfonylpiperidine (PubChem CID 3419642) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]-1-(4-propylphenyl)sulfonylpiperidine.
| Compound Name | 4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]-1-(4-propylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 3419642 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]-1-(4-propylphenyl)sulfonylpiperidine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCC(c3nccn3CCOCCOCC)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O4S/c1-3-5-20-6-8-22(9-7-20)31(27,28)26-13-10-21(11-14-26)23-24-12-15-25(23)16-17-30-19-18-29-4-2/h6-9,12,15,21H,3-5,10-11,13-14,16-19H2,1-2H3 |
| InChIKey | KWEGTJWZWVQYHB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|