C23H35N3O4 — CID 5015414
2-[3-[[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methyl]phenoxy]ethanol (PubChem CID 5015414) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[3-[[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 5015414 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 2-[3-[[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methyl]phenoxy]ethanol |
| SMILES | CCOCCOCCn1ccnc1C1CCN(Cc2cccc(OCCO)c2)CC1 |
| InChI | InChI=1S/C23H35N3O4/c1-2-28-16-17-29-14-12-26-11-8-24-23(26)21-6-9-25(10-7-21)19-20-4-3-5-22(18-20)30-15-13-27/h3-5,8,11,18,21,27H,2,6-7,9-10,12-17,19H2,1H3 |
| InChIKey | UNPCZIYMRBIPMN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|