C23H31N3O5 — CID 3312454
2,3-dihydro-1,4-benzodioxin-3-yl-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 3312454) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 3312454 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | CCOCCOCCn1ccnc1C1CCN(C(=O)C2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C23H31N3O5/c1-2-28-15-16-29-14-13-25-12-9-24-22(25)18-7-10-26(11-8-18)23(27)21-17-30-19-5-3-4-6-20(19)31-21/h3-6,9,12,18,21H,2,7-8,10-11,13-17H2,1H3 |
| InChIKey | RYVRKHIJOIXYDI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|