C18H22Cl2N4O3 — CID 3856154
(3,6-dichloro-2-pyridinyl)-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 3856154) has the molecular formula C18H22Cl2N4O3 and a molecular weight of 413.31 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 3856154 |
| Molecular Formula | C18H22Cl2N4O3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | COCCOCn1ccnc1C1CCN(C(=O)c2nc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H22Cl2N4O3/c1-26-10-11-27-12-24-9-6-21-17(24)13-4-7-23(8-5-13)18(25)16-14(19)2-3-15(20)22-16/h2-3,6,9,13H,4-5,7-8,10-12H2,1H3 |
| InChIKey | JJOZISOICLYGBW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|