C10H10Cl2N2O2 — CID 103723510
(3,6-dichloro-2-pyridinyl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 103723510) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 103723510 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C10H10Cl2N2O2/c11-7-1-2-8(12)13-9(7)10(16)14-4-3-6(15)5-14/h1-2,6,15H,3-5H2/t6-/m0/s1 |
| InChIKey | NENKMEJGGOPYQI-LURJTMIESA-N |
| XLogP | 1.60 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|