C13H17Cl2N3O — CID 63633965
(3,6-dichloro-2-pyridinyl)-(3-ethyl-4-methylpiperazin-1-yl)methanone (PubChem CID 63633965) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-(3-ethyl-4-methylpiperazin-1-yl)methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-(3-ethyl-4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63633965 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-(3-ethyl-4-methylpiperazin-1-yl)methanone |
| SMILES | CCC1CN(C(=O)c2nc(Cl)ccc2Cl)CCN1C |
| InChI | InChI=1S/C13H17Cl2N3O/c1-3-9-8-18(7-6-17(9)2)13(19)12-10(14)4-5-11(15)16-12/h4-5,9H,3,6-8H2,1-2H3 |
| InChIKey | NBFPYPYANRUAFA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|