C15H19Cl2N3O — CID 61051195
(3,6-dichloro-2-pyridinyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 61051195) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 61051195 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C15H19Cl2N3O/c16-12-5-6-13(17)18-14(12)15(21)20-9-3-4-11(10-20)19-7-1-2-8-19/h5-6,11H,1-4,7-10H2 |
| InChIKey | RNEUIGVSWPOLOI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|