C14H19ClN4O — CID 79946116
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[3-chloro-6-(methylamino)-2-pyridinyl]methanone (PubChem CID 79946116) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[3-chloro-6-(methylamino)-2-pyridinyl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[3-chloro-6-(methylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 79946116 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[3-chloro-6-(methylamino)-2-pyridinyl]methanone |
| SMILES | CNc1ccc(Cl)c(C(=O)N2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C14H19ClN4O/c1-16-12-5-4-11(15)13(17-12)14(20)19-8-7-18-6-2-3-10(18)9-19/h4-5,10H,2-3,6-9H2,1H3,(H,16,17) |
| InChIKey | ZUCMENOYDUORPQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |