C19H21Cl2N3O2 — CID 34563260
(3,6-dichloro-2-pyridinyl)-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 34563260) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 34563260 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(CN2CCN(C(=O)c3nc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-2-26-15-5-3-14(4-6-15)13-23-9-11-24(12-10-23)19(25)18-16(20)7-8-17(21)22-18/h3-8H,2,9-13H2,1H3 |
| InChIKey | YYHCPDYCSJVPKF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|