C24H27N3O2 — CID 34563464
[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone (PubChem CID 34563464) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone.
| Compound Name | [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 34563464 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
| SMILES | CCOc1ccc(CN2CCN(C(=O)c3ccc(-n4cccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-2-29-23-11-5-20(6-12-23)19-25-15-17-27(18-16-25)24(28)21-7-9-22(10-8-21)26-13-3-4-14-26/h3-14H,2,15-19H2,1H3 |
| InChIKey | IXHNGYQPBMOKBS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |