C21H24N6O2 — CID 39191568
[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 39191568) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 39191568 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | CCOc1ccc(CN2CCN(C(=O)c3cccc(-n4cnnn4)c3)CC2)cc1 |
| InChI | InChI=1S/C21H24N6O2/c1-2-29-20-8-6-17(7-9-20)15-25-10-12-26(13-11-25)21(28)18-4-3-5-19(14-18)27-16-22-23-24-27/h3-9,14,16H,2,10-13,15H2,1H3 |
| InChIKey | WIAQOUJXLYHLEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |