C16H16N8O — CID 26519874
(4-pyrimidin-2-ylpiperazin-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 26519874) has the molecular formula C16H16N8O and a molecular weight of 336.36 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 26519874 |
| Molecular Formula | C16H16N8O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H16N8O/c25-15(13-3-1-4-14(11-13)24-12-19-20-21-24)22-7-9-23(10-8-22)16-17-5-2-6-18-16/h1-6,11-12H,7-10H2 |
| InChIKey | HDMZESNYFKAXKH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |