C18H20N8O2 — CID 122332371
[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 122332371) has the molecular formula C18H20N8O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is [4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 122332371 |
| Molecular Formula | C18H20N8O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | COc1cc(N2CCN(C(=O)c3cccc(-n4cnnn4)c3)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H20N8O2/c1-13-20-16(11-17(21-13)28-2)24-6-8-25(9-7-24)18(27)14-4-3-5-15(10-14)26-12-19-22-23-26/h3-5,10-12H,6-9H2,1-2H3 |
| InChIKey | XVSQJCDIKLDOIG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 102.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |