C25H28N4O6 — CID 171676603
3,4,5-trimethoxy-N-[1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperidin-3-yl]benzamide (PubChem CID 171676603) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperidin-3-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 171676603 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperidin-3-yl]benzamide |
| SMILES | COc1cc(C(=O)NC2CCCN(C(=O)Cc3n[nH]c(=O)c4ccccc34)C2)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N4O6/c1-33-20-11-15(12-21(34-2)23(20)35-3)24(31)26-16-7-6-10-29(14-16)22(30)13-19-17-8-4-5-9-18(17)25(32)28-27-19/h4-5,8-9,11-12,16H,6-7,10,13-14H2,1-3H3,(H,26,31)(H,28,32) |
| InChIKey | PFOSLZCUOHZEAL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |