C22H25N5O2S2 — CID 3853442
N-(2-methyl-5-nitrophenyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3853442) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3853442 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-4-[1-(2-thiophen-3-ylethyl)imidazol-2-yl]piperidine-1-carbothioamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=S)N1CCC(c2nccn2CCc2ccsc2)CC1 |
| InChI | InChI=1S/C22H25N5O2S2/c1-16-2-3-19(27(28)29)14-20(16)24-22(30)26-10-5-18(6-11-26)21-23-8-12-25(21)9-4-17-7-13-31-15-17/h2-3,7-8,12-15,18H,4-6,9-11H2,1H3,(H,24,30) |
| InChIKey | PZOOLCYGIXGNDL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|