C20H24N4O4S — CID 90522852
N'-(2-methyl-5-nitrophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide (PubChem CID 90522852) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-(2-methyl-5-nitrophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide.
| Compound Name | N'-(2-methyl-5-nitrophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 90522852 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N'-(2-methyl-5-nitrophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)NCCN1CCC(c2cccs2)CC1 |
| InChI | InChI=1S/C20H24N4O4S/c1-14-4-5-16(24(27)28)13-17(14)22-20(26)19(25)21-8-11-23-9-6-15(7-10-23)18-3-2-12-29-18/h2-5,12-13,15H,6-11H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | CMCFORYCEDTHRJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|