C19H22FN3O2S — CID 90522812
N'-(2-fluorophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide (PubChem CID 90522812) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide.
| Compound Name | N'-(2-fluorophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 90522812 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N'-(2-fluorophenyl)-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1CCC(c2cccs2)CC1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H22FN3O2S/c20-15-4-1-2-5-16(15)22-19(25)18(24)21-9-12-23-10-7-14(8-11-23)17-6-3-13-26-17/h1-6,13-14H,7-12H2,(H,21,24)(H,22,25) |
| InChIKey | SCBFGQSKNICOOK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|