C17H24N4OS2 — CID 71787081
4-propyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]thiadiazole-5-carboxamide (PubChem CID 71787081) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 4-propyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-propyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 71787081 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-propyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]thiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCCN1CCC(c2cccs2)CC1 |
| InChI | InChI=1S/C17H24N4OS2/c1-2-4-14-16(24-20-19-14)17(22)18-8-11-21-9-6-13(7-10-21)15-5-3-12-23-15/h3,5,12-13H,2,4,6-11H2,1H3,(H,18,22) |
| InChIKey | SBIBBMCWTXGSMG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |