C25H29N3OS — CID 90522912
1-benzhydryl-3-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]urea (PubChem CID 90522912) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]urea.
| Compound Name | 1-benzhydryl-3-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 90522912 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-benzhydryl-3-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]urea |
| SMILES | O=C(NCCN1CCC(c2cccs2)CC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3OS/c29-25(26-15-18-28-16-13-20(14-17-28)23-12-7-19-30-23)27-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-12,19-20,24H,13-18H2,(H2,26,27,29) |
| InChIKey | LKVHEQSJNUXHOH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |