C21H28N2O2S — CID 43066076
1-(3-cyclohexyloxypropyl)-3-[phenyl(thiophen-2-yl)methyl]urea (PubChem CID 43066076) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-[phenyl(thiophen-2-yl)methyl]urea.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-[phenyl(thiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 43066076 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-[phenyl(thiophen-2-yl)methyl]urea |
| SMILES | O=C(NCCCOC1CCCCC1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H28N2O2S/c24-21(22-14-8-15-25-18-11-5-2-6-12-18)23-20(19-13-7-16-26-19)17-9-3-1-4-10-17/h1,3-4,7,9-10,13,16,18,20H,2,5-6,8,11-12,14-15H2,(H2,22,23,24) |
| InChIKey | YRNMSTVLMJDIPZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|