C25H29N5O5S — CID 3748440
4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide (PubChem CID 3748440) has the molecular formula C25H29N5O5S and a molecular weight of 511.60 g/mol. Its IUPAC name is 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3748440 |
| Molecular Formula | C25H29N5O5S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide |
| SMILES | COc1cc(Cn2ccnc2C2CCN(C(=S)Nc3ccc([N+](=O)[O-])cc3OC)CC2)cc(OC)c1 |
| InChI | InChI=1S/C25H29N5O5S/c1-33-20-12-17(13-21(15-20)34-2)16-29-11-8-26-24(29)18-6-9-28(10-7-18)25(36)27-22-5-4-19(30(31)32)14-23(22)35-3/h4-5,8,11-15,18H,6-7,9-10,16H2,1-3H3,(H,27,36) |
| InChIKey | FAMXIBQDVIQKSV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|