C24H37N5OS — CID 3353571
N-[3-(diethylamino)propyl]-4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3353571) has the molecular formula C24H37N5OS and a molecular weight of 443.66 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3353571 |
| Molecular Formula | C24H37N5OS |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-[1-[(4-methoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
| SMILES | CCN(CC)CCCNC(=S)N1CCC(c2nccn2Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H37N5OS/c1-4-27(5-2)15-6-13-26-24(31)28-16-11-21(12-17-28)23-25-14-18-29(23)19-20-7-9-22(30-3)10-8-20/h7-10,14,18,21H,4-6,11-13,15-17,19H2,1-3H3,(H,26,31) |
| InChIKey | LIFXKPXWSQPZRR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|