C20H34N4S — CID 19289372
N-[3-(diethylamino)propyl]-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19289372) has the molecular formula C20H34N4S and a molecular weight of 362.59 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289372 |
| Molecular Formula | C20H34N4S |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-[(4-methylphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | CCN(CC)CCCNC(=S)N1CCN(Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H34N4S/c1-4-22(5-2)12-6-11-21-20(25)24-15-13-23(14-16-24)17-19-9-7-18(3)8-10-19/h7-10H,4-6,11-17H2,1-3H3,(H,21,25) |
| InChIKey | ARHOOGHHKDQPFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|