C17H26ClFN4S — CID 19574278
4-[(2-chloro-4-fluorophenyl)methyl]-N-[3-(dimethylamino)propyl]piperazine-1-carbothioamide (PubChem CID 19574278) has the molecular formula C17H26ClFN4S and a molecular weight of 372.94 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenyl)methyl]-N-[3-(dimethylamino)propyl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-[3-(dimethylamino)propyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574278 |
| Molecular Formula | C17H26ClFN4S |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-[3-(dimethylamino)propyl]piperazine-1-carbothioamide |
| SMILES | CN(C)CCCNC(=S)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClFN4S/c1-21(2)7-3-6-20-17(24)23-10-8-22(9-11-23)13-14-4-5-15(19)12-16(14)18/h4-5,12H,3,6-11,13H2,1-2H3,(H,20,24) |
| InChIKey | HSXQOYCNRHPEQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|