C20H23ClFN3O3 — CID 34820631
N-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]furan-2-carboxamide (PubChem CID 34820631) has the molecular formula C20H23ClFN3O3 and a molecular weight of 407.87 g/mol. Its IUPAC name is N-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34820631 |
| Molecular Formula | C20H23ClFN3O3 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(Cc2ccc(F)cc2Cl)CC1)c1ccco1 |
| InChI | InChI=1S/C20H23ClFN3O3/c21-17-13-16(22)6-5-15(17)14-24-8-10-25(11-9-24)19(26)4-1-7-23-20(27)18-3-2-12-28-18/h2-3,5-6,12-13H,1,4,7-11,14H2,(H,23,27) |
| InChIKey | RALCEFIPDMGHMN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|