C19H20ClFN2O2 — CID 86852812
[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone (PubChem CID 86852812) has the molecular formula C19H20ClFN2O2 and a molecular weight of 362.83 g/mol. Its IUPAC name is [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone.
| Compound Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 86852812 |
| Molecular Formula | C19H20ClFN2O2 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone |
| SMILES | O=C(C1CC1c1ccco1)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H20ClFN2O2/c20-17-10-14(21)4-3-13(17)12-22-5-7-23(8-6-22)19(24)16-11-15(16)18-2-1-9-25-18/h1-4,9-10,15-16H,5-8,11-12H2 |
| InChIKey | YSWRAKYIOIAPIR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |