C21H22Cl2N2O — CID 19294877
[2-(4-chlorophenyl)cyclopropyl]-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19294877) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is [2-(4-chlorophenyl)cyclopropyl]-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [2-(4-chlorophenyl)cyclopropyl]-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19294877 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [2-(4-chlorophenyl)cyclopropyl]-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1CC1c1ccc(Cl)cc1)N1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O/c22-17-7-5-15(6-8-17)18-13-19(18)21(26)25-11-9-24(10-12-25)14-16-3-1-2-4-20(16)23/h1-8,18-19H,9-14H2 |
| InChIKey | ZFDCRLJZAHGWIR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |