C15H21ClFN3S — CID 19574293
4-[(2-chloro-4-fluorophenyl)methyl]-N-propylpiperazine-1-carbothioamide (PubChem CID 19574293) has the molecular formula C15H21ClFN3S and a molecular weight of 329.87 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenyl)methyl]-N-propylpiperazine-1-carbothioamide.
| Compound Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-propylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574293 |
| Molecular Formula | C15H21ClFN3S |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-propylpiperazine-1-carbothioamide |
| SMILES | CCCNC(=S)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C15H21ClFN3S/c1-2-5-18-15(21)20-8-6-19(7-9-20)11-12-3-4-13(17)10-14(12)16/h3-4,10H,2,5-9,11H2,1H3,(H,18,21) |
| InChIKey | AEAZQMFSKWVBAY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|