C22H21Cl3FN5S — CID 19574321
4-[(2-chloro-4-fluorophenyl)methyl]-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide (PubChem CID 19574321) has the molecular formula C22H21Cl3FN5S and a molecular weight of 512.87 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenyl)methyl]-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574321 |
| Molecular Formula | C22H21Cl3FN5S |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenyl)methyl]-N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
| SMILES | Fc1ccc(CN2CCN(C(=S)Nc3ccn(Cc4c(Cl)cccc4Cl)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H21Cl3FN5S/c23-18-2-1-3-19(24)17(18)14-31-7-6-21(28-31)27-22(32)30-10-8-29(9-11-30)13-15-4-5-16(26)12-20(15)25/h1-7,12H,8-11,13-14H2,(H,27,28,32) |
| InChIKey | YQCPISZGNQKVAN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|