C21H26ClN7S — CID 19291760
N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide (PubChem CID 19291760) has the molecular formula C21H26ClN7S and a molecular weight of 444.01 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19291760 |
| Molecular Formula | C21H26ClN7S |
| Molecular Weight | 444.01 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=S)Nc2ccn(Cc3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C21H26ClN7S/c1-16-18(13-26(2)24-16)14-27-9-11-28(12-10-27)21(30)23-20-7-8-29(25-20)15-17-5-3-4-6-19(17)22/h3-8,13H,9-12,14-15H2,1-2H3,(H,23,25,30) |
| InChIKey | NESSBPKQWNEADV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|