C22H22Cl2FN5S — CID 19574531
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-4-[(2-chlorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19574531) has the molecular formula C22H22Cl2FN5S and a molecular weight of 478.42 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-4-[(2-chlorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-4-[(2-chlorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574531 |
| Molecular Formula | C22H22Cl2FN5S |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-4-[(2-chlorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Fc1cccc(Cl)c1Cn1ccc(NC(=S)N2CCN(Cc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C22H22Cl2FN5S/c23-18-5-2-1-4-16(18)14-28-10-12-29(13-11-28)22(31)26-21-8-9-30(27-21)15-17-19(24)6-3-7-20(17)25/h1-9H,10-15H2,(H,26,27,31) |
| InChIKey | AYENCIYXTLOQTO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|