C22H23ClFN5S — CID 17024064
4-benzyl-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide (PubChem CID 17024064) has the molecular formula C22H23ClFN5S and a molecular weight of 443.98 g/mol. Its IUPAC name is 4-benzyl-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17024064 |
| Molecular Formula | C22H23ClFN5S |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-benzyl-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
| SMILES | Fc1cccc(Cl)c1Cn1ccc(NC(=S)N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C22H23ClFN5S/c23-19-7-4-8-20(24)18(19)16-29-10-9-21(26-29)25-22(30)28-13-11-27(12-14-28)15-17-5-2-1-3-6-17/h1-10H,11-16H2,(H,25,26,30) |
| InChIKey | OALBWJGARSIHKI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|