C22H21Cl2F2N5S — CID 19574446
N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-4-[(2,3-difluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 19574446) has the molecular formula C22H21Cl2F2N5S and a molecular weight of 496.41 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-4-[(2,3-difluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-4-[(2,3-difluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574446 |
| Molecular Formula | C22H21Cl2F2N5S |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-4-[(2,3-difluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | Fc1cccc(CN2CCN(C(=S)Nc3ccn(Cc4c(Cl)cccc4Cl)n3)CC2)c1F |
| InChI | InChI=1S/C22H21Cl2F2N5S/c23-17-4-2-5-18(24)16(17)14-31-8-7-20(28-31)27-22(32)30-11-9-29(10-12-30)13-15-3-1-6-19(25)21(15)26/h1-8H,9-14H2,(H,27,28,32) |
| InChIKey | UMGGLJJHYICPMM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|