C23H25Cl2N5S — CID 19289331
4-[(2,4-dichlorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide (PubChem CID 19289331) has the molecular formula C23H25Cl2N5S and a molecular weight of 474.46 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19289331 |
| Molecular Formula | C23H25Cl2N5S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1Cn1ccc(NC(=S)N2CCN(Cc3ccc(Cl)cc3Cl)CC2)n1 |
| InChI | InChI=1S/C23H25Cl2N5S/c1-17-4-2-3-5-18(17)16-30-9-8-22(27-30)26-23(31)29-12-10-28(11-13-29)15-19-6-7-20(24)14-21(19)25/h2-9,14H,10-13,15-16H2,1H3,(H,26,27,31) |
| InChIKey | DUVRZRKJGOOTKZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|