C19H23ClN4S — CID 134437755
4-[(2-chlorophenyl)methyl]-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide (PubChem CID 134437755) has the molecular formula C19H23ClN4S and a molecular weight of 374.94 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(2-chlorophenyl)methyl]-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 134437755 |
| Molecular Formula | C19H23ClN4S |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-N-(4,6-dimethyl-2-pyridinyl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(Cc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H23ClN4S/c1-14-11-15(2)21-18(12-14)22-19(25)24-9-7-23(8-10-24)13-16-5-3-4-6-17(16)20/h3-6,11-12H,7-10,13H2,1-2H3,(H,21,22,25) |
| InChIKey | RCUFXHNFIBRDCK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|