C20H25ClN4S — CID 23934915
N-[(2-chlorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide (PubChem CID 23934915) has the molecular formula C20H25ClN4S and a molecular weight of 388.97 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 23934915 |
| Molecular Formula | C20H25ClN4S |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-1,4-diazepane-1-carbothioamide |
| SMILES | Cc1cccc(CN2CCCN(C(=S)NCc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C20H25ClN4S/c1-16-6-4-8-18(23-16)15-24-10-5-11-25(13-12-24)20(26)22-14-17-7-2-3-9-19(17)21/h2-4,6-9H,5,10-15H2,1H3,(H,22,26) |
| InChIKey | BCLURZLSVNYLDE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|