C20H28ClN5S — CID 19574540
4-[(2-chlorophenyl)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperazine-1-carbothioamide (PubChem CID 19574540) has the molecular formula C20H28ClN5S and a molecular weight of 406.00 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2-chlorophenyl)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574540 |
| Molecular Formula | C20H28ClN5S |
| Molecular Weight | 406.00 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)n(CCCNC(=S)N2CCN(Cc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C20H28ClN5S/c1-16-14-17(2)26(23-16)9-5-8-22-20(27)25-12-10-24(11-13-25)15-18-6-3-4-7-19(18)21/h3-4,6-7,14H,5,8-13,15H2,1-2H3,(H,22,27) |
| InChIKey | NRIHCSDLSQJKFD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.00 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|