C21H31N5O2 — CID 119064710
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-(2-phenoxyethyl)piperazine-1-carboxamide (PubChem CID 119064710) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-(2-phenoxyethyl)piperazine-1-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-(2-phenoxyethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 119064710 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-(2-phenoxyethyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)N2CCN(CCOc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H31N5O2/c1-18-17-19(2)26(23-18)10-6-9-22-21(27)25-13-11-24(12-14-25)15-16-28-20-7-4-3-5-8-20/h3-5,7-8,17H,6,9-16H2,1-2H3,(H,22,27) |
| InChIKey | HBFKSOYSDIRTTJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|