C21H30FN5O2 — CID 112803454
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 112803454) has the molecular formula C21H30FN5O2 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112803454 |
| Molecular Formula | C21H30FN5O2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-[(5-fluoro-2-methoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(F)cc1CN1CCN(C(=O)NCCCn2nc(C)cc2C)CC1 |
| InChI | InChI=1S/C21H30FN5O2/c1-16-13-17(2)27(24-16)8-4-7-23-21(28)26-11-9-25(10-12-26)15-18-14-19(22)5-6-20(18)29-3/h5-6,13-14H,4,7-12,15H2,1-3H3,(H,23,28) |
| InChIKey | YMIRKOMNFATPOW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|