C20H36N6O2 — CID 86999458
4-[2-(diethylamino)-2-oxoethyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,4-diazepane-1-carboxamide (PubChem CID 86999458) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-[2-(diethylamino)-2-oxoethyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(diethylamino)-2-oxoethyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 86999458 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-[2-(diethylamino)-2-oxoethyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1,4-diazepane-1-carboxamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)NCCCn2nc(C)cc2C)CC1 |
| InChI | InChI=1S/C20H36N6O2/c1-5-24(6-2)19(27)16-23-10-8-11-25(14-13-23)20(28)21-9-7-12-26-18(4)15-17(3)22-26/h15H,5-14,16H2,1-4H3,(H,21,28) |
| InChIKey | IHDQNSSYDJXMAX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|