C22H39N7O — CID 111837575
1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 111837575) has the molecular formula C22H39N7O and a molecular weight of 417.60 g/mol. Its IUPAC name is 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111837575 |
| Molecular Formula | C22H39N7O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCCN1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C22H39N7O/c1-18-17-19(2)29(26-18)11-6-9-24-22(23-3)25-10-12-27-13-15-28(16-14-27)21(30)20-7-4-5-8-20/h17,20H,4-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | AHJWYRMRENAHAH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|