C23H44N6O — CID 111839641
1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111839641) has the molecular formula C23H44N6O and a molecular weight of 420.65 g/mol. Its IUPAC name is 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111839641 |
| Molecular Formula | C23H44N6O |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCC(C)CC1)NCCN1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H44N6O/c1-20-8-13-27(14-9-20)12-5-10-25-23(24-2)26-11-15-28-16-18-29(19-17-28)22(30)21-6-3-4-7-21/h20-21H,3-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | LBIDRVVZZZQEKE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|