C24H47IN6O — CID 111567248
1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111567248) has the molecular formula C24H47IN6O and a molecular weight of 562.59 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111567248 |
| Molecular Formula | C24H47IN6O |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCN(C(=O)C2CCC2)CC1)NCC(C(C)C)N1CCCCCC1.I |
| InChI | InChI=1S/C24H46N6O.HI/c1-20(2)22(29-12-6-4-5-7-13-29)19-27-24(25-3)26-11-14-28-15-17-30(18-16-28)23(31)21-9-8-10-21;/h20-22H,4-19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | ZBYKGOYOPBVNOS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|