C20H38N6O — CID 111567065
1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine (PubChem CID 111567065) has the molecular formula C20H38N6O and a molecular weight of 378.57 g/mol. Its IUPAC name is 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111567065 |
| Molecular Formula | C20H38N6O |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCN1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C20H38N6O/c1-3-25-10-5-8-18(25)16-23-20(21-2)22-9-11-24-12-14-26(15-13-24)19(27)17-6-4-7-17/h17-18H,3-16H2,1-2H3,(H2,21,22,23) |
| InChIKey | VEJLZPPUBJYZML-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|