C21H43IN6O2 — CID 111261502
tert-butyl 4-[3-[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111261502) has the molecular formula C21H43IN6O2 and a molecular weight of 538.52 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[3-[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111261502 |
| Molecular Formula | C21H43IN6O2 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl 4-[3-[[N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCCCN1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C21H42N6O2.HI/c1-6-26-12-7-9-18(26)17-24-19(22-5)23-10-8-11-25-13-15-27(16-14-25)20(28)29-21(2,3)4;/h18H,6-17H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | VHQPADOZKAAASR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|