C21H40N6O2 — CID 111566967
1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111566967) has the molecular formula C21H40N6O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111566967 |
| Molecular Formula | C21H40N6O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCN1CCN(C(=O)C2CCC2)CC1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C21H40N6O2/c1-21(2,27-13-15-29-16-14-27)17-24-20(22-3)23-7-8-25-9-11-26(12-10-25)19(28)18-5-4-6-18/h18H,4-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | NYZQFGWMLJKKQH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|