C14H25N5O3S — CID 126436509
(3S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide (PubChem CID 126436509) has the molecular formula C14H25N5O3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126436509 |
| Molecular Formula | C14H25N5O3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (3S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)N2CC[C@H](CS(N)(=O)=O)C2)n1 |
| InChI | InChI=1S/C14H25N5O3S/c1-11-8-12(2)19(17-11)6-3-5-16-14(20)18-7-4-13(9-18)10-23(15,21)22/h8,13H,3-7,9-10H2,1-2H3,(H,16,20)(H2,15,21,22)/t13-/m0/s1 |
| InChIKey | FMQHYGQKRVZIJQ-ZDUSSCGKSA-N |
| XLogP | 0.21 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|