C20H35N5O — CID 28882866
(3R)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide (PubChem CID 28882866) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is (3R)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28882866 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | (3R)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(1-methylpiperidin-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)[C@@H]2CCCN(C3CCN(C)CC3)C2)n1 |
| InChI | InChI=1S/C20H35N5O/c1-16-14-17(2)25(22-16)11-5-9-21-20(26)18-6-4-10-24(15-18)19-7-12-23(3)13-8-19/h14,18-19H,4-13,15H2,1-3H3,(H,21,26)/t18-/m1/s1 |
| InChIKey | BTBMADQEPCSVNX-GOSISDBHSA-N |
| XLogP | 1.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|