C15H23N3O — CID 94182966
(1S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohex-3-ene-1-carboxamide (PubChem CID 94182966) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (1S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 94182966 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (1S)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)[C@@H]2CC=CCC2)n1 |
| InChI | InChI=1S/C15H23N3O/c1-12-11-13(2)18(17-12)10-6-9-16-15(19)14-7-4-3-5-8-14/h3-4,11,14H,5-10H2,1-2H3,(H,16,19)/t14-/m1/s1 |
| InChIKey | IXMMGVFPCXTMBK-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|